C7H3Br2N3O2 — CID 171662384
3,6-dibromo-5-nitro-2H-indazole (PubChem CID 171662384) has the molecular formula C7H3Br2N3O2 and a molecular weight of 320.93 g/mol. Its IUPAC name is 3,6-dibromo-5-nitro-2H-indazole.
| Compound Name | 3,6-dibromo-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 171662384 |
| Molecular Formula | C7H3Br2N3O2 |
| Molecular Weight | 320.93 g/mol |
| Exact Mass | 318.86 |
| IUPAC Name | 3,6-dibromo-5-nitro-2H-indazole |
| SMILES | O=[N+]([O-])c1cc2c(Br)[nH]nc2cc1Br |
| InChI | InChI=1S/C7H3Br2N3O2/c8-4-2-5-3(7(9)11-10-5)1-6(4)12(13)14/h1-2H,(H,10,11) |
| InChIKey | MQMQDTLMZWPPGE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|