About 1-bromo-4,5-diiodo-2-nitrobenzene
1-bromo-4,5-diiodo-2-nitrobenzene (PubChem CID 11503393) has the molecular formula C6H2BrI2NO2
and a molecular weight of 453.80 g/mol. Its IUPAC name is 1-bromo-4,5-diiodo-2-nitrobenzene.
Molecular Properties
| Compound Name | 1-bromo-4,5-diiodo-2-nitrobenzene |
| PubChem CID | 11503393 |
| Molecular Formula | C6H2BrI2NO2 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.74 |
| IUPAC Name | 1-bromo-4,5-diiodo-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(I)c(I)cc1Br |
| InChI | InChI=1S/C6H2BrI2NO2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H |
| InChIKey | XIGXOXHVUCPVFD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4,5-diiodo-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4,5-diiodo-2-nitrobenzene?
The IUPAC name of 1-bromo-4,5-diiodo-2-nitrobenzene (CID 11503393) is 1-bromo-4,5-diiodo-2-nitrobenzene.
What is the SMILES notation for 1-bromo-4,5-diiodo-2-nitrobenzene?
The canonical SMILES for 1-bromo-4,5-diiodo-2-nitrobenzene is O=[N+]([O-])c1cc(I)c(I)cc1Br.
What is the InChIKey of 1-bromo-4,5-diiodo-2-nitrobenzene?
The InChIKey is XIGXOXHVUCPVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrI2NO2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H.
What are the key properties of 1-bromo-4,5-diiodo-2-nitrobenzene?
1-bromo-4,5-diiodo-2-nitrobenzene has a molecular weight of 453.80 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4,5-diiodo-2-nitrobenzene is sourced from PubChem (CID 11503393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).