C9H11BrN2O2 — CID 118834303
4-bromo-N,N,2-trimethyl-5-nitroaniline (PubChem CID 118834303) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 4-bromo-N,N,2-trimethyl-5-nitroaniline.
| Compound Name | 4-bromo-N,N,2-trimethyl-5-nitroaniline |
|---|---|
| PubChem CID | 118834303 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-bromo-N,N,2-trimethyl-5-nitroaniline |
| SMILES | Cc1cc(Br)c([N+](=O)[O-])cc1N(C)C |
| InChI | InChI=1S/C9H11BrN2O2/c1-6-4-7(10)9(12(13)14)5-8(6)11(2)3/h4-5H,1-3H3 |
| InChIKey | BAWMUMCSINLUOA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|