C8H8BrClN2O2 — CID 50879556
2-bromo-4-chloro-N,N-dimethyl-6-nitroaniline (PubChem CID 50879556) has the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. Its IUPAC name is 2-bromo-4-chloro-N,N-dimethyl-6-nitroaniline.
| Compound Name | 2-bromo-4-chloro-N,N-dimethyl-6-nitroaniline |
|---|---|
| PubChem CID | 50879556 |
| Molecular Formula | C8H8BrClN2O2 |
| Molecular Weight | 279.52 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | 2-bromo-4-chloro-N,N-dimethyl-6-nitroaniline |
| SMILES | CN(C)c1c(Br)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8BrClN2O2/c1-11(2)8-6(9)3-5(10)4-7(8)12(13)14/h3-4H,1-2H3 |
| InChIKey | MCBGORSOAWTADL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|