C10H12BrClN2O2 — CID 50879567
2-bromo-4-chloro-N,N-diethyl-6-nitroaniline (PubChem CID 50879567) has the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. Its IUPAC name is 2-bromo-4-chloro-N,N-diethyl-6-nitroaniline.
| Compound Name | 2-bromo-4-chloro-N,N-diethyl-6-nitroaniline |
|---|---|
| PubChem CID | 50879567 |
| Molecular Formula | C10H12BrClN2O2 |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-bromo-4-chloro-N,N-diethyl-6-nitroaniline |
| SMILES | CCN(CC)c1c(Br)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12BrClN2O2/c1-3-13(4-2)10-8(11)5-7(12)6-9(10)14(15)16/h5-6H,3-4H2,1-2H3 |
| InChIKey | BIMXZPVFNZBADQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|