C14H7Br2ClF3N3O4 — CID 13218729
N-(2,6-dibromo-4-chlorophenyl)-N-methyl-2,4-dinitro-6-(trifluoromethyl)aniline (PubChem CID 13218729) has the molecular formula C14H7Br2ClF3N3O4 and a molecular weight of 533.48 g/mol. Its IUPAC name is N-(2,6-dibromo-4-chlorophenyl)-N-methyl-2,4-dinitro-6-(trifluoromethyl)aniline.
| Compound Name | N-(2,6-dibromo-4-chlorophenyl)-N-methyl-2,4-dinitro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 13218729 |
| Molecular Formula | C14H7Br2ClF3N3O4 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 530.84 |
| IUPAC Name | N-(2,6-dibromo-4-chlorophenyl)-N-methyl-2,4-dinitro-6-(trifluoromethyl)aniline |
| SMILES | CN(c1c(Br)cc(Cl)cc1Br)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C14H7Br2ClF3N3O4/c1-21(13-9(15)2-6(17)3-10(13)16)12-8(14(18,19)20)4-7(22(24)25)5-11(12)23(26)27/h2-5H,1H3 |
| InChIKey | DUHUVPSNWHONJS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|