C16H12F3N3O4 — CID 88624844
2,4-dinitro-N-phenyl-N-prop-2-enyl-6-(trifluoromethyl)aniline (PubChem CID 88624844) has the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is 2,4-dinitro-N-phenyl-N-prop-2-enyl-6-(trifluoromethyl)aniline.
| Compound Name | 2,4-dinitro-N-phenyl-N-prop-2-enyl-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 88624844 |
| Molecular Formula | C16H12F3N3O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2,4-dinitro-N-phenyl-N-prop-2-enyl-6-(trifluoromethyl)aniline |
| SMILES | C=CCN(c1ccccc1)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O4/c1-2-8-20(11-6-4-3-5-7-11)15-13(16(17,18)19)9-12(21(23)24)10-14(15)22(25)26/h2-7,9-10H,1,8H2 |
| InChIKey | GZWIGFRBHATOML-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|