C17H13F6N3O4 — CID 20551064
2,4-dinitro-N-propyl-6-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]aniline (PubChem CID 20551064) has the molecular formula C17H13F6N3O4 and a molecular weight of 437.30 g/mol. Its IUPAC name is 2,4-dinitro-N-propyl-6-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2,4-dinitro-N-propyl-6-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 20551064 |
| Molecular Formula | C17H13F6N3O4 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2,4-dinitro-N-propyl-6-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]aniline |
| SMILES | CCCN(c1cccc(C(F)(F)F)c1)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C17H13F6N3O4/c1-2-6-24(11-5-3-4-10(7-11)16(18,19)20)15-13(17(21,22)23)8-12(25(27)28)9-14(15)26(29)30/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | JJELBYPDFQGNEK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|