C18H13BrF6N2O4 — CID 22327411
ethyl N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 22327411) has the molecular formula C18H13BrF6N2O4 and a molecular weight of 515.20 g/mol. Its IUPAC name is ethyl N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22327411 |
| Molecular Formula | C18H13BrF6N2O4 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | ethyl N-[4-bromo-2-nitro-6-(trifluoromethyl)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1cccc(C(F)(F)F)c1)c1c([N+](=O)[O-])cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13BrF6N2O4/c1-2-31-16(28)26(9-10-4-3-5-11(6-10)17(20,21)22)15-13(18(23,24)25)7-12(19)8-14(15)27(29)30/h3-8H,2,9H2,1H3 |
| InChIKey | NRCRIOSGOGJVDM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|