C11H11F3N2O3 — CID 3054397
ethyl N-carbamoyl-N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 3054397) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is ethyl N-carbamoyl-N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | ethyl N-carbamoyl-N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 3054397 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethyl N-carbamoyl-N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CCOC(=O)N(C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O3/c1-2-19-10(18)16(9(15)17)8-5-3-4-7(6-8)11(12,13)14/h3-6H,2H2,1H3,(H2,15,17) |
| InChIKey | XIKPYGNPUIVKGX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |