C14H17F3N2O3 — CID 113061465
ethyl N-[2-[N-acetyl-3-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 113061465) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is ethyl N-[2-[N-acetyl-3-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[N-acetyl-3-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113061465 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl N-[2-[N-acetyl-3-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(C(C)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-3-22-13(21)18-7-8-19(10(2)20)12-6-4-5-11(9-12)14(15,16)17/h4-6,9H,3,7-8H2,1-2H3,(H,18,21) |
| InChIKey | JTCJOCNYWMUQSA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |