C14H18N2O5 — CID 113062992
ethyl N-[2-[acetyl(1,3-benzodioxol-5-yl)amino]ethyl]carbamate (PubChem CID 113062992) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl N-[2-[acetyl(1,3-benzodioxol-5-yl)amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[acetyl(1,3-benzodioxol-5-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 113062992 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | ethyl N-[2-[acetyl(1,3-benzodioxol-5-yl)amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(C(C)=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O5/c1-3-19-14(18)15-6-7-16(10(2)17)11-4-5-12-13(8-11)21-9-20-12/h4-5,8H,3,6-7,9H2,1-2H3,(H,15,18) |
| InChIKey | OGFHINCCUQNWIK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |