C14H18N2O4 — CID 113178212
2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-propylacetamide (PubChem CID 113178212) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-propylacetamide.
| Compound Name | 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 113178212 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C(C)=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O4/c1-3-6-15-14(18)8-16(10(2)17)11-4-5-12-13(7-11)20-9-19-12/h4-5,7H,3,6,8-9H2,1-2H3,(H,15,18) |
| InChIKey | ULWOEBZXQMVGOF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |