C15H20N2O5 — CID 113178398
2-[acetyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 113178398) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[acetyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[acetyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113178398 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[acetyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C(C)=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H20N2O5/c1-11(18)17(10-15(19)16-5-6-20-2)12-3-4-13-14(9-12)22-8-7-21-13/h3-4,9H,5-8,10H2,1-2H3,(H,16,19) |
| InChIKey | NKEWQEMEAOGGQI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|