C15H20N2O4 — CID 113175557
2-(N,4-diacetylanilino)-N-(2-methoxyethyl)acetamide (PubChem CID 113175557) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(N,4-diacetylanilino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(N,4-diacetylanilino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113175557 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-(N,4-diacetylanilino)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C(C)=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-11(18)13-4-6-14(7-5-13)17(12(2)19)10-15(20)16-8-9-21-3/h4-7H,8-10H2,1-3H3,(H,16,20) |
| InChIKey | ZRVIFYGSXXXOLA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|