C19H21N3O4 — CID 113178353
2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 113178353) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 113178353 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[acetyl(1,3-benzodioxol-5-yl)amino]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(N(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N3O4/c1-13(23)22(16-8-9-17-18(10-16)26-12-25-17)11-19(24)20-14-4-6-15(7-5-14)21(2)3/h4-10H,11-12H2,1-3H3,(H,20,24) |
| InChIKey | PFYHGINDEMEOOH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|