C20H20N2O6 — CID 113132944
methyl 4-[3-[acetyl(1,3-benzodioxol-5-yl)amino]propanoylamino]benzoate (PubChem CID 113132944) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 4-[3-[acetyl(1,3-benzodioxol-5-yl)amino]propanoylamino]benzoate.
| Compound Name | methyl 4-[3-[acetyl(1,3-benzodioxol-5-yl)amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 113132944 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | methyl 4-[3-[acetyl(1,3-benzodioxol-5-yl)amino]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCN(C(C)=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H20N2O6/c1-13(23)22(16-7-8-17-18(11-16)28-12-27-17)10-9-19(24)21-15-5-3-14(4-6-15)20(25)26-2/h3-8,11H,9-10,12H2,1-2H3,(H,21,24) |
| InChIKey | ZSHJQVCOAKRJPF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |