methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate

C21H22N2O5 — CID 113130750

IUPACmethyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CCN(C(C)=O)c2cccc(C(C)=O)c2)cc1
InChIInChI=1S/C21H22N2O5/c1-14(24)17-5-4-6-19(13-17)23(15(2)25)12-11-20(26)22-18-9-7-16(8-10-18)21(27)28-3/h4-10,13H,11-12H2,1-3H3,(H,22,26)
InChIKeyHYDHTGLGVKDAPH-UHFFFAOYSA-N
MW382.42 g/mol
LogP3.06
Rot. Bonds7

About methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate

methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate (PubChem CID 113130750) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate.

Molecular Properties

Compound Namemethyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate
PubChem CID113130750
Molecular FormulaC21H22N2O5
Molecular Weight382.42 g/mol
Exact Mass382.15
IUPAC Namemethyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CCN(C(C)=O)c2cccc(C(C)=O)c2)cc1
InChIInChI=1S/C21H22N2O5/c1-14(24)17-5-4-6-19(13-17)23(15(2)25)12-11-20(26)22-18-9-7-16(8-10-18)21(27)28-3/h4-10,13H,11-12H2,1-3H3,(H,22,26)
InChIKeyHYDHTGLGVKDAPH-UHFFFAOYSA-N
XLogP3.06
TPSA92.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms28
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500382.42
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate?
The IUPAC name of methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate (CID 113130750) is methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate.
What is the SMILES notation for methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate?
The canonical SMILES for methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate is COC(=O)c1ccc(NC(=O)CCN(C(C)=O)c2cccc(C(C)=O)c2)cc1.
What is the InChIKey of methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate?
The InChIKey is HYDHTGLGVKDAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O5/c1-14(24)17-5-4-6-19(13-17)23(15(2)25)12-11-20(26)22-18-9-7-16(8-10-18)21(27)28-3/h4-10,13H,11-12H2,1-3H3,(H,22,26).
What are the key properties of methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate?
methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate has a molecular weight of 382.42 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate is sourced from PubChem (CID 113130750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).