C21H22N2O5 — CID 113130750
methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate (PubChem CID 113130750) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate.
| Compound Name | methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate |
|---|---|
| PubChem CID | 113130750 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 4-[3-(N,3-diacetylanilino)propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCN(C(C)=O)c2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-14(24)17-5-4-6-19(13-17)23(15(2)25)12-11-20(26)22-18-9-7-16(8-10-18)21(27)28-3/h4-10,13H,11-12H2,1-3H3,(H,22,26) |
| InChIKey | HYDHTGLGVKDAPH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |