C20H20N2O5 — CID 113176469
methyl 4-[acetyl-[2-(3-acetylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 113176469) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl 4-[acetyl-[2-(3-acetylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-[acetyl-[2-(3-acetylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 113176469 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | methyl 4-[acetyl-[2-(3-acetylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)Nc2cccc(C(C)=O)c2)C(C)=O)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-13(23)16-5-4-6-17(11-16)21-19(25)12-22(14(2)24)18-9-7-15(8-10-18)20(26)27-3/h4-11H,12H2,1-3H3,(H,21,25) |
| InChIKey | DDFQNKVAAHUIJM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |