C18H16Cl2N2O4 — CID 113132956
3-[acetyl(1,3-benzodioxol-5-yl)amino]-N-(2,4-dichlorophenyl)propanamide (PubChem CID 113132956) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 3-[acetyl(1,3-benzodioxol-5-yl)amino]-N-(2,4-dichlorophenyl)propanamide.
| Compound Name | 3-[acetyl(1,3-benzodioxol-5-yl)amino]-N-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 113132956 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-[acetyl(1,3-benzodioxol-5-yl)amino]-N-(2,4-dichlorophenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccc(Cl)cc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-11(23)22(13-3-5-16-17(9-13)26-10-25-16)7-6-18(24)21-15-4-2-12(19)8-14(15)20/h2-5,8-9H,6-7,10H2,1H3,(H,21,24) |
| InChIKey | SDEVCVRIMVFUPY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |