C15H20N2O4 — CID 113061688
ethyl N-[2-(N,4-diacetylanilino)ethyl]carbamate (PubChem CID 113061688) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl N-[2-(N,4-diacetylanilino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(N,4-diacetylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113061688 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl N-[2-(N,4-diacetylanilino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(C(C)=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-4-21-15(20)16-9-10-17(12(3)19)14-7-5-13(6-8-14)11(2)18/h5-8H,4,9-10H2,1-3H3,(H,16,20) |
| InChIKey | IIEHVMQWVFZLSY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |