C17H22N2O3 — CID 113061690
N-[2-(N,4-diacetylanilino)ethyl]cyclobutanecarboxamide (PubChem CID 113061690) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[2-(N,4-diacetylanilino)ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(N,4-diacetylanilino)ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113061690 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[2-(N,4-diacetylanilino)ethyl]cyclobutanecarboxamide |
| SMILES | CC(=O)c1ccc(N(CCNC(=O)C2CCC2)C(C)=O)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(20)14-6-8-16(9-7-14)19(13(2)21)11-10-18-17(22)15-4-3-5-15/h6-9,15H,3-5,10-11H2,1-2H3,(H,18,22) |
| InChIKey | VBJQKQUGUGYZLU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |