C19H27N3O3 — CID 113061686
N-(4-acetylphenyl)-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide (PubChem CID 113061686) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide.
| Compound Name | N-(4-acetylphenyl)-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113061686 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(4-acetylphenyl)-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(N(CCNC(=O)NC2CCCCC2)C(C)=O)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-14(23)16-8-10-18(11-9-16)22(15(2)24)13-12-20-19(25)21-17-6-4-3-5-7-17/h8-11,17H,3-7,12-13H2,1-2H3,(H2,20,21,25) |
| InChIKey | HQSBXIXDCXWGTP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |