C22H16F6O3S — CID 86622215
ethyl 5-[hydroxy-bis[3-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxylate (PubChem CID 86622215) has the molecular formula C22H16F6O3S and a molecular weight of 474.42 g/mol. Its IUPAC name is ethyl 5-[hydroxy-bis[3-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-[hydroxy-bis[3-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86622215 |
| Molecular Formula | C22H16F6O3S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | ethyl 5-[hydroxy-bis[3-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(O)(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H16F6O3S/c1-2-31-19(29)17-9-10-18(32-17)20(30,13-5-3-7-15(11-13)21(23,24)25)14-6-4-8-16(12-14)22(26,27)28/h3-12,30H,2H2,1H3 |
| InChIKey | LFZOWABRVWUUGM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |