C15H11F3N2O3 — CID 70144203
4-[N-carbamoyl-3-(trifluoromethyl)anilino]benzoic acid (PubChem CID 70144203) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 4-[N-carbamoyl-3-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 4-[N-carbamoyl-3-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 70144203 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[N-carbamoyl-3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | NC(=O)N(c1ccc(C(=O)O)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N2O3/c16-15(17,18)10-2-1-3-12(8-10)20(14(19)23)11-6-4-9(5-7-11)13(21)22/h1-8H,(H2,19,23)(H,21,22) |
| InChIKey | PMUFCYRHOFJJIN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |