C25H21F4N3O3 — CID 87368432
4-[4-[4-[fluoro-[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]piperazin-1-yl]benzoic acid (PubChem CID 87368432) has the molecular formula C25H21F4N3O3 and a molecular weight of 487.45 g/mol. Its IUPAC name is 4-[4-[4-[fluoro-[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-[fluoro-[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 87368432 |
| Molecular Formula | C25H21F4N3O3 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[4-[4-[fluoro-[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(c3ccc(C(=O)N(F)c4cccc(C(F)(F)F)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H21F4N3O3/c26-25(27,28)19-2-1-3-22(16-19)32(29)23(33)17-4-8-20(9-5-17)30-12-14-31(15-13-30)21-10-6-18(7-11-21)24(34)35/h1-11,16H,12-15H2,(H,34,35) |
| InChIKey | HHHRTXPMTPNVKD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|