C20H20F3N3O — CID 70084992
1-(3-ethyl-1,2-dimethylindol-5-yl)-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 70084992) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is 1-(3-ethyl-1,2-dimethylindol-5-yl)-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-ethyl-1,2-dimethylindol-5-yl)-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 70084992 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(3-ethyl-1,2-dimethylindol-5-yl)-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCc1c(C)n(C)c2ccc(N(C(N)=O)c3cccc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C20H20F3N3O/c1-4-16-12(2)25(3)18-9-8-15(11-17(16)18)26(19(24)27)14-7-5-6-13(10-14)20(21,22)23/h5-11H,4H2,1-3H3,(H2,24,27) |
| InChIKey | SBIQLWVJGFRKQZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|