C18H20N4O — CID 19016482
1-(3-ethyl-1,2-dimethylindol-5-yl)-3-pyridin-2-ylurea (PubChem CID 19016482) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(3-ethyl-1,2-dimethylindol-5-yl)-3-pyridin-2-ylurea.
| Compound Name | 1-(3-ethyl-1,2-dimethylindol-5-yl)-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 19016482 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-(3-ethyl-1,2-dimethylindol-5-yl)-3-pyridin-2-ylurea |
| SMILES | CCc1c(C)n(C)c2ccc(NC(=O)Nc3ccccn3)cc12 |
| InChI | InChI=1S/C18H20N4O/c1-4-14-12(2)22(3)16-9-8-13(11-15(14)16)20-18(23)21-17-7-5-6-10-19-17/h5-11H,4H2,1-3H3,(H2,19,20,21,23) |
| InChIKey | SPGYKNHGPRWVCA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|