C17H17ClF3N3O2 — CID 87977801
ethyl N-benzyl-N-[2,4-diamino-3-chloro-6-(trifluoromethyl)phenyl]carbamate (PubChem CID 87977801) has the molecular formula C17H17ClF3N3O2 and a molecular weight of 387.79 g/mol. Its IUPAC name is ethyl N-benzyl-N-[2,4-diamino-3-chloro-6-(trifluoromethyl)phenyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[2,4-diamino-3-chloro-6-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87977801 |
| Molecular Formula | C17H17ClF3N3O2 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | ethyl N-benzyl-N-[2,4-diamino-3-chloro-6-(trifluoromethyl)phenyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)c1c(C(F)(F)F)cc(N)c(Cl)c1N |
| InChI | InChI=1S/C17H17ClF3N3O2/c1-2-26-16(25)24(9-10-6-4-3-5-7-10)15-11(17(19,20)21)8-12(22)13(18)14(15)23/h3-8H,2,9,22-23H2,1H3 |
| InChIKey | UBFFAGUWBHUPGK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|