C18H15BrF6N2O2 — CID 87975968
ethyl N-[[2-amino-4-bromo-3,6-bis(trifluoromethyl)phenyl]methyl]-N-phenylcarbamate (PubChem CID 87975968) has the molecular formula C18H15BrF6N2O2 and a molecular weight of 485.22 g/mol. Its IUPAC name is ethyl N-[[2-amino-4-bromo-3,6-bis(trifluoromethyl)phenyl]methyl]-N-phenylcarbamate.
| Compound Name | ethyl N-[[2-amino-4-bromo-3,6-bis(trifluoromethyl)phenyl]methyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 87975968 |
| Molecular Formula | C18H15BrF6N2O2 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | ethyl N-[[2-amino-4-bromo-3,6-bis(trifluoromethyl)phenyl]methyl]-N-phenylcarbamate |
| SMILES | CCOC(=O)N(Cc1c(C(F)(F)F)cc(Br)c(C(F)(F)F)c1N)c1ccccc1 |
| InChI | InChI=1S/C18H15BrF6N2O2/c1-2-29-16(28)27(10-6-4-3-5-7-10)9-11-12(17(20,21)22)8-13(19)14(15(11)26)18(23,24)25/h3-8H,2,9,26H2,1H3 |
| InChIKey | GYMXZODNHUPBDY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|