C15H15BrN4O4 — CID 86614485
ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-benzylcarbamate (PubChem CID 86614485) has the molecular formula C15H15BrN4O4 and a molecular weight of 395.21 g/mol. Its IUPAC name is ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-benzylcarbamate.
| Compound Name | ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-benzylcarbamate |
|---|---|
| PubChem CID | 86614485 |
| Molecular Formula | C15H15BrN4O4 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-benzylcarbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)c1cc(Br)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15BrN4O4/c1-2-24-15(21)19(9-10-6-4-3-5-7-10)11-8-12(16)18-14(17)13(11)20(22)23/h3-8H,2,9H2,1H3,(H2,17,18) |
| InChIKey | UFSYMZWYMNKUHM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|