C17H24N6O4 — CID 160966999
ethyl N-[2-amino-6-(methylamino)-3-nitro-4-pyridinyl]-N-benzylcarbamate;methanamine (PubChem CID 160966999) has the molecular formula C17H24N6O4 and a molecular weight of 376.42 g/mol. Its IUPAC name is ethyl N-[2-amino-6-(methylamino)-3-nitro-4-pyridinyl]-N-benzylcarbamate;methanamine.
| Compound Name | ethyl N-[2-amino-6-(methylamino)-3-nitro-4-pyridinyl]-N-benzylcarbamate;methanamine |
|---|---|
| PubChem CID | 160966999 |
| Molecular Formula | C17H24N6O4 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | ethyl N-[2-amino-6-(methylamino)-3-nitro-4-pyridinyl]-N-benzylcarbamate;methanamine |
| SMILES | CCOC(=O)N(Cc1ccccc1)c1cc(NC)nc(N)c1[N+](=O)[O-].CN |
| InChI | InChI=1S/C16H19N5O4.CH5N/c1-3-25-16(22)20(10-11-7-5-4-6-8-11)12-9-13(18-2)19-15(17)14(12)21(23)24;1-2/h4-9H,3,10H2,1-2H3,(H3,17,18,19);2H2,1H3 |
| InChIKey | SXTGCNRITITACT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|