C16H18N6O4 — CID 14530472
ethyl N-[6-amino-4-[[(E)-benzylideneamino]-methylamino]-5-nitro-2-pyridinyl]carbamate (PubChem CID 14530472) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is ethyl N-[6-amino-4-[[(E)-benzylideneamino]-methylamino]-5-nitro-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-amino-4-[[(E)-benzylideneamino]-methylamino]-5-nitro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 14530472 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethyl N-[6-amino-4-[[(E)-benzylideneamino]-methylamino]-5-nitro-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(N(C)/N=C/c2ccccc2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C16H18N6O4/c1-3-26-16(23)20-13-9-12(14(22(24)25)15(17)19-13)21(2)18-10-11-7-5-4-6-8-11/h4-10H,3H2,1-2H3,(H3,17,19,20,23)/b18-10+ |
| InChIKey | GJFZQPGGVILGMX-VCHYOVAHSA-N |
| XLogP | 2.61 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|