C12H18N8O5 — CID 59302656
ethyl N-[6-amino-4-[[(2E)-2-(carbamoylhydrazinylidene)propyl]amino]-5-nitro-2-pyridinyl]carbamate (PubChem CID 59302656) has the molecular formula C12H18N8O5 and a molecular weight of 354.33 g/mol. Its IUPAC name is ethyl N-[6-amino-4-[[(2E)-2-(carbamoylhydrazinylidene)propyl]amino]-5-nitro-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-amino-4-[[(2E)-2-(carbamoylhydrazinylidene)propyl]amino]-5-nitro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 59302656 |
| Molecular Formula | C12H18N8O5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl N-[6-amino-4-[[(2E)-2-(carbamoylhydrazinylidene)propyl]amino]-5-nitro-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(NC/C(C)=N/NC(N)=O)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C12H18N8O5/c1-3-25-12(22)17-8-4-7(9(20(23)24)10(13)16-8)15-5-6(2)18-19-11(14)21/h4H,3,5H2,1-2H3,(H3,14,19,21)(H4,13,15,16,17,22)/b18-6+ |
| InChIKey | LWTAWTYYPQHXSV-NGYBGAFCSA-N |
| XLogP | 0.60 |
| TPSA | 199.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|