C9H14N8O4 — CID 137048086
[(Z)-1-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)-methylamino]propan-2-ylideneamino]urea (PubChem CID 137048086) has the molecular formula C9H14N8O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is [(Z)-1-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)-methylamino]propan-2-ylideneamino]urea.
| Compound Name | [(Z)-1-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)-methylamino]propan-2-ylideneamino]urea |
|---|---|
| PubChem CID | 137048086 |
| Molecular Formula | C9H14N8O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(Z)-1-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)-methylamino]propan-2-ylideneamino]urea |
| SMILES | C/C(CN(C)c1nc(N)[nH]c(=O)c1[N+](=O)[O-])=N/NC(N)=O |
| InChI | InChI=1S/C9H14N8O4/c1-4(14-15-9(11)19)3-16(2)6-5(17(20)21)7(18)13-8(10)12-6/h3H2,1-2H3,(H3,11,15,19)(H3,10,12,13,18)/b14-4- |
| InChIKey | CAYUYYCGVYECQR-CPSFFCFKSA-N |
| XLogP | -1.26 |
| TPSA | 185.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|