C11H18N6O3 — CID 80808538
2-[(6-amino-5-nitropyrimidin-4-yl)-methylamino]-N,N-diethylacetamide (PubChem CID 80808538) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(6-amino-5-nitropyrimidin-4-yl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(6-amino-5-nitropyrimidin-4-yl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 80808538 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[(6-amino-5-nitropyrimidin-4-yl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N6O3/c1-4-16(5-2)8(18)6-15(3)11-9(17(19)20)10(12)13-7-14-11/h7H,4-6H2,1-3H3,(H2,12,13,14) |
| InChIKey | ROAOHKGSIBCZMV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|