C7H8F3N5O2 — CID 80791146
4-N-methyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine (PubChem CID 80791146) has the molecular formula C7H8F3N5O2 and a molecular weight of 251.17 g/mol. Its IUPAC name is 4-N-methyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80791146 |
| Molecular Formula | C7H8F3N5O2 |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-N-methyl-5-nitro-4-N-(2,2,2-trifluoroethyl)pyrimidine-4,6-diamine |
| SMILES | CN(CC(F)(F)F)c1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8F3N5O2/c1-14(2-7(8,9)10)6-4(15(16)17)5(11)12-3-13-6/h3H,2H2,1H3,(H2,11,12,13) |
| InChIKey | ONLTYYKWGKWOSN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|