C12H17BrN4O3 — CID 61455761
2-[(5-bromo-3-nitro-2-pyridinyl)-methylamino]-N,N-diethylacetamide (PubChem CID 61455761) has the molecular formula C12H17BrN4O3 and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-[(5-bromo-3-nitro-2-pyridinyl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(5-bromo-3-nitro-2-pyridinyl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 61455761 |
| Molecular Formula | C12H17BrN4O3 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[(5-bromo-3-nitro-2-pyridinyl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1ncc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BrN4O3/c1-4-16(5-2)11(18)8-15(3)12-10(17(19)20)6-9(13)7-14-12/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | UFFMCKQQBDMVNS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|