C9H12ClN5O3 — CID 62101026
2-[(6-chloro-5-nitropyrimidin-4-yl)-methylamino]-N,N-dimethylacetamide (PubChem CID 62101026) has the molecular formula C9H12ClN5O3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-[(6-chloro-5-nitropyrimidin-4-yl)-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(6-chloro-5-nitropyrimidin-4-yl)-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62101026 |
| Molecular Formula | C9H12ClN5O3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[(6-chloro-5-nitropyrimidin-4-yl)-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12ClN5O3/c1-13(2)6(16)4-14(3)9-7(15(17)18)8(10)11-5-12-9/h5H,4H2,1-3H3 |
| InChIKey | OESTWZWMHIZJLX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|