C22H24N6O5 — CID 57235452
ethyl N-[6-amino-4-[2-[3-(4-methylanilino)-2-oxopropyl]pyrrol-2-yl]-5-nitro-2-pyridinyl]carbamate (PubChem CID 57235452) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl N-[6-amino-4-[2-[3-(4-methylanilino)-2-oxopropyl]pyrrol-2-yl]-5-nitro-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-amino-4-[2-[3-(4-methylanilino)-2-oxopropyl]pyrrol-2-yl]-5-nitro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 57235452 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl N-[6-amino-4-[2-[3-(4-methylanilino)-2-oxopropyl]pyrrol-2-yl]-5-nitro-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(C2(CC(=O)CNc3ccc(C)cc3)C=CC=N2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C22H24N6O5/c1-3-33-21(30)27-18-11-17(19(28(31)32)20(23)26-18)22(9-4-10-25-22)12-16(29)13-24-15-7-5-14(2)6-8-15/h4-11,24H,3,12-13H2,1-2H3,(H3,23,26,27,30) |
| InChIKey | LCGVEYQNLFVZIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|