C17H21N5O5 — CID 5270473
ethyl N-[6-amino-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]-5-nitro-2-pyridinyl]carbamate (PubChem CID 5270473) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl N-[6-amino-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]-5-nitro-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-amino-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]-5-nitro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 5270473 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl N-[6-amino-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]-5-nitro-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(N[C@@H](C)[C@H](O)c2ccccc2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C17H21N5O5/c1-3-27-17(24)21-13-9-12(14(22(25)26)16(18)20-13)19-10(2)15(23)11-7-5-4-6-8-11/h4-10,15,23H,3H2,1-2H3,(H4,18,19,20,21,24)/t10-,15-/m0/s1 |
| InChIKey | MTFAZWAEQHVUAK-BONVTDFDSA-N |
| XLogP | 2.67 |
| TPSA | 152.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|