C15H16N4O5 — CID 70358675
[6-amino-4-(1-hydroxy-1-phenylpropan-2-yl)-5-nitro-2-pyridinyl]carbamic acid (PubChem CID 70358675) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is [6-amino-4-(1-hydroxy-1-phenylpropan-2-yl)-5-nitro-2-pyridinyl]carbamic acid.
| Compound Name | [6-amino-4-(1-hydroxy-1-phenylpropan-2-yl)-5-nitro-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 70358675 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [6-amino-4-(1-hydroxy-1-phenylpropan-2-yl)-5-nitro-2-pyridinyl]carbamic acid |
| SMILES | CC(c1cc(NC(=O)O)nc(N)c1[N+](=O)[O-])C(O)c1ccccc1 |
| InChI | InChI=1S/C15H16N4O5/c1-8(13(20)9-5-3-2-4-6-9)10-7-11(18-15(21)22)17-14(16)12(10)19(23)24/h2-8,13,20H,1H3,(H,21,22)(H3,16,17,18) |
| InChIKey | JSEQWKDKIRNQMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|