C21H20N5O4- — CID 57352309
N-[6-amino-4-(benzhydrylamino)-5-nitro-2-pyridinyl]-N-ethylcarbamate (PubChem CID 57352309) has the molecular formula C21H20N5O4- and a molecular weight of 406.42 g/mol. Its IUPAC name is N-[6-amino-4-(benzhydrylamino)-5-nitro-2-pyridinyl]-N-ethylcarbamate.
| Compound Name | N-[6-amino-4-(benzhydrylamino)-5-nitro-2-pyridinyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 57352309 |
| Molecular Formula | C21H20N5O4- |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[6-amino-4-(benzhydrylamino)-5-nitro-2-pyridinyl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)[O-])c1cc(NC(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-2-25(21(27)28)17-13-16(19(26(29)30)20(22)24-17)23-18(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,18H,2H2,1H3,(H,27,28)(H3,22,23,24)/p-1 |
| InChIKey | BJBSKRUZSGUXAJ-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|