C15H15N5O5 — CID 67834606
[6-amino-5-nitro-4-[[(2S)-1-oxo-1-phenylpropan-2-yl]amino]-2-pyridinyl] carbamate (PubChem CID 67834606) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is [6-amino-5-nitro-4-[[(2S)-1-oxo-1-phenylpropan-2-yl]amino]-2-pyridinyl] carbamate.
| Compound Name | [6-amino-5-nitro-4-[[(2S)-1-oxo-1-phenylpropan-2-yl]amino]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 67834606 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [6-amino-5-nitro-4-[[(2S)-1-oxo-1-phenylpropan-2-yl]amino]-2-pyridinyl] carbamate |
| SMILES | C[C@H](Nc1cc(OC(N)=O)nc(N)c1[N+](=O)[O-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15N5O5/c1-8(13(21)9-5-3-2-4-6-9)18-10-7-11(25-15(17)22)19-14(16)12(10)20(23)24/h2-8H,1H3,(H2,17,22)(H3,16,18,19)/t8-/m0/s1 |
| InChIKey | LKKZPGNUIBQOOM-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|