C20H26BrN4O7P — CID 86667762
ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-[[4-(diethoxyphosphorylmethyl)phenyl]methyl]carbamate (PubChem CID 86667762) has the molecular formula C20H26BrN4O7P and a molecular weight of 545.33 g/mol. Its IUPAC name is ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-[[4-(diethoxyphosphorylmethyl)phenyl]methyl]carbamate.
| Compound Name | ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-[[4-(diethoxyphosphorylmethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86667762 |
| Molecular Formula | C20H26BrN4O7P |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | ethyl N-(2-amino-6-bromo-3-nitro-4-pyridinyl)-N-[[4-(diethoxyphosphorylmethyl)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccc(CP(=O)(OCC)OCC)cc1)c1cc(Br)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26BrN4O7P/c1-4-30-20(26)24(16-11-17(21)23-19(22)18(16)25(27)28)12-14-7-9-15(10-8-14)13-33(29,31-5-2)32-6-3/h7-11H,4-6,12-13H2,1-3H3,(H2,22,23) |
| InChIKey | DXBMJPYQFGBAGP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|