C15H9F3N4O4 — CID 13218719
4-[N-methyl-2,4-dinitro-6-(trifluoromethyl)anilino]benzonitrile (PubChem CID 13218719) has the molecular formula C15H9F3N4O4 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-[N-methyl-2,4-dinitro-6-(trifluoromethyl)anilino]benzonitrile.
| Compound Name | 4-[N-methyl-2,4-dinitro-6-(trifluoromethyl)anilino]benzonitrile |
|---|---|
| PubChem CID | 13218719 |
| Molecular Formula | C15H9F3N4O4 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-[N-methyl-2,4-dinitro-6-(trifluoromethyl)anilino]benzonitrile |
| SMILES | CN(c1ccc(C#N)cc1)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C15H9F3N4O4/c1-20(10-4-2-9(8-19)3-5-10)14-12(15(16,17)18)6-11(21(23)24)7-13(14)22(25)26/h2-7H,1H3 |
| InChIKey | HYPJXBPFPFERDI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|