C23H28F4N6O8 — CID 158309934
N-butyl-N-ethyl-2,4-dinitro-6-(trifluoromethyl)aniline;N,N-diethyl-2-fluoro-4,6-dinitroaniline (PubChem CID 158309934) has the molecular formula C23H28F4N6O8 and a molecular weight of 592.50 g/mol. Its IUPAC name is N-butyl-N-ethyl-2,4-dinitro-6-(trifluoromethyl)aniline;N,N-diethyl-2-fluoro-4,6-dinitroaniline.
| Compound Name | N-butyl-N-ethyl-2,4-dinitro-6-(trifluoromethyl)aniline;N,N-diethyl-2-fluoro-4,6-dinitroaniline |
|---|---|
| PubChem CID | 158309934 |
| Molecular Formula | C23H28F4N6O8 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-butyl-N-ethyl-2,4-dinitro-6-(trifluoromethyl)aniline;N,N-diethyl-2-fluoro-4,6-dinitroaniline |
| SMILES | CCCCN(CC)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F.CCN(CC)c1c(F)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16F3N3O4.C10H12FN3O4/c1-3-5-6-17(4-2)12-10(13(14,15)16)7-9(18(20)21)8-11(12)19(22)23;1-3-12(4-2)10-8(11)5-7(13(15)16)6-9(10)14(17)18/h7-8H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | GNOBJLIAINDYOJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|