C12H19FN4O2 — CID 166477825
2-N-[2-(dimethylamino)ethyl]-2-N-ethyl-3-fluoro-5-nitrobenzene-1,2-diamine (PubChem CID 166477825) has the molecular formula C12H19FN4O2 and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-2-N-ethyl-3-fluoro-5-nitrobenzene-1,2-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-2-N-ethyl-3-fluoro-5-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 166477825 |
| Molecular Formula | C12H19FN4O2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-2-N-ethyl-3-fluoro-5-nitrobenzene-1,2-diamine |
| SMILES | CCN(CCN(C)C)c1c(N)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H19FN4O2/c1-4-16(6-5-15(2)3)12-10(13)7-9(17(18)19)8-11(12)14/h7-8H,4-6,14H2,1-3H3 |
| InChIKey | XDJBRNUVYYVJEA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|