C10H12F2N2O3 — CID 103847000
2-(2,6-difluoro-N-methyl-4-nitroanilino)propan-1-ol (PubChem CID 103847000) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-(2,6-difluoro-N-methyl-4-nitroanilino)propan-1-ol.
| Compound Name | 2-(2,6-difluoro-N-methyl-4-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 103847000 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-(2,6-difluoro-N-methyl-4-nitroanilino)propan-1-ol |
| SMILES | CC(CO)N(C)c1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H12F2N2O3/c1-6(5-15)13(2)10-8(11)3-7(14(16)17)4-9(10)12/h3-4,6,15H,5H2,1-2H3 |
| InChIKey | KIAXSYBKGBQUKD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|