C10H12F3N3O3 — CID 106750090
2-[methyl-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-1-ol (PubChem CID 106750090) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-[methyl-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-1-ol.
| Compound Name | 2-[methyl-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 106750090 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[methyl-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-1-ol |
| SMILES | CC(CO)N(C)c1cc(C(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12F3N3O3/c1-6(5-17)15(2)7-3-9(10(11,12)13)14-4-8(7)16(18)19/h3-4,6,17H,5H2,1-2H3 |
| InChIKey | BRXUMWQBOCDPFH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|